C21H22N2O4 — CID 119033787
2-[bis(4-methoxyphenyl)methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 119033787) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[bis(4-methoxyphenyl)methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 2-[bis(4-methoxyphenyl)methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 119033787 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[bis(4-methoxyphenyl)methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)N2C(=O)C3CCCN3C2=O)cc1 |
| InChI | InChI=1S/C21H22N2O4/c1-26-16-9-5-14(6-10-16)19(15-7-11-17(27-2)12-8-15)23-20(24)18-4-3-13-22(18)21(23)25/h5-12,18-19H,3-4,13H2,1-2H3 |
| InChIKey | NAAFSJFXRPGPJX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|