C19H20N2O3 — CID 52905379
(2'S,3R)-2'-(2,4-dimethoxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 52905379) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2'S,3R)-2'-(2,4-dimethoxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'S,3R)-2'-(2,4-dimethoxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 52905379 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2'S,3R)-2'-(2,4-dimethoxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | COc1ccc([C@@H]2NCC[C@]23C(=O)Nc2ccccc23)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-23-12-7-8-13(16(11-12)24-2)17-19(9-10-20-17)14-5-3-4-6-15(14)21-18(19)22/h3-8,11,17,20H,9-10H2,1-2H3,(H,21,22)/t17-,19+/m0/s1 |
| InChIKey | GBTHJECCVJUPQA-PKOBYXMFSA-N |
| XLogP | 2.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |