About 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol
2-amino-2,3-dihydro-1,3-benzoxazol-6-ol (PubChem CID 135257276) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol.
Molecular Properties
| Compound Name | 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol |
| PubChem CID | 135257276 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol |
| SMILES | NC1Nc2ccc(O)cc2O1 |
| InChI | InChI=1S/C7H8N2O2/c8-7-9-5-2-1-4(10)3-6(5)11-7/h1-3,7,9-10H,8H2 |
| InChIKey | JFPZWPXTCMXPKL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol?
The IUPAC name of 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol (CID 135257276) is 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol.
What is the SMILES notation for 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol?
The canonical SMILES for 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol is NC1Nc2ccc(O)cc2O1.
What is the InChIKey of 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol?
The InChIKey is JFPZWPXTCMXPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c8-7-9-5-2-1-4(10)3-6(5)11-7/h1-3,7,9-10H,8H2.
What are the key properties of 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol?
2-amino-2,3-dihydro-1,3-benzoxazol-6-ol has a molecular weight of 152.15 g/mol, XLogP of 0.44, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2,3-dihydro-1,3-benzoxazol-6-ol is sourced from PubChem (CID 135257276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).