C16H17NO2 — CID 82228787
2-[(3-methylphenyl)methyl]-3,4-dihydro-2H-1,4-benzoxazin-7-ol (PubChem CID 82228787) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methyl]-3,4-dihydro-2H-1,4-benzoxazin-7-ol.
| Compound Name | 2-[(3-methylphenyl)methyl]-3,4-dihydro-2H-1,4-benzoxazin-7-ol |
|---|---|
| PubChem CID | 82228787 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-[(3-methylphenyl)methyl]-3,4-dihydro-2H-1,4-benzoxazin-7-ol |
| SMILES | Cc1cccc(CC2CNc3ccc(O)cc3O2)c1 |
| InChI | InChI=1S/C16H17NO2/c1-11-3-2-4-12(7-11)8-14-10-17-15-6-5-13(18)9-16(15)19-14/h2-7,9,14,17-18H,8,10H2,1H3 |
| InChIKey | YXBXFQIWPDYVPR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|