About 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol
2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol (PubChem CID 69369715) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol.
Molecular Properties
| Compound Name | 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol |
| PubChem CID | 69369715 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol |
| SMILES | CC1CNc2ccc(O)cc2O1 |
| InChI | InChI=1S/C9H11NO2/c1-6-5-10-8-3-2-7(11)4-9(8)12-6/h2-4,6,10-11H,5H2,1H3 |
| InChIKey | FZARGFGUVKFTGV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol?
The IUPAC name of 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol (CID 69369715) is 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol is CC1CNc2ccc(O)cc2O1.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol?
The InChIKey is FZARGFGUVKFTGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-5-10-8-3-2-7(11)4-9(8)12-6/h2-4,6,10-11H,5H2,1H3.
What are the key properties of 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol?
2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol has a molecular weight of 165.19 g/mol, XLogP of 1.59, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-ol is sourced from PubChem (CID 69369715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).