C9H10FNO — CID 84717188
4-fluoro-1,2,3,4-tetrahydroquinolin-6-ol (PubChem CID 84717188) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is 4-fluoro-1,2,3,4-tetrahydroquinolin-6-ol.
| Compound Name | 4-fluoro-1,2,3,4-tetrahydroquinolin-6-ol |
|---|---|
| PubChem CID | 84717188 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 4-fluoro-1,2,3,4-tetrahydroquinolin-6-ol |
| SMILES | Oc1ccc2c(c1)C(F)CCN2 |
| InChI | InChI=1S/C9H10FNO/c10-8-3-4-11-9-2-1-6(12)5-7(8)9/h1-2,5,8,11-12H,3-4H2 |
| InChIKey | KCBULCQZNDYSEN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|