C13H17NO2 — CID 115098139
spiro[3,4-dihydro-1,4-benzoxazine-2,1'-cyclohexane]-7-ol (PubChem CID 115098139) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is spiro[3,4-dihydro-1,4-benzoxazine-2,1'-cyclohexane]-7-ol.
| Compound Name | spiro[3,4-dihydro-1,4-benzoxazine-2,1'-cyclohexane]-7-ol |
|---|---|
| PubChem CID | 115098139 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | spiro[3,4-dihydro-1,4-benzoxazine-2,1'-cyclohexane]-7-ol |
| SMILES | Oc1ccc2c(c1)OC1(CCCCC1)CN2 |
| InChI | InChI=1S/C13H17NO2/c15-10-4-5-11-12(8-10)16-13(9-14-11)6-2-1-3-7-13/h4-5,8,14-15H,1-3,6-7,9H2 |
| InChIKey | UDKAGXLANFFWPO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|