C14H16O3 — CID 3243908
6-hydroxyspiro[3H-chromene-2,1'-cyclohexane]-4-one (PubChem CID 3243908) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 6-hydroxyspiro[3H-chromene-2,1'-cyclohexane]-4-one.
| Compound Name | 6-hydroxyspiro[3H-chromene-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 3243908 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 6-hydroxyspiro[3H-chromene-2,1'-cyclohexane]-4-one |
| SMILES | O=C1CC2(CCCCC2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C14H16O3/c15-10-4-5-13-11(8-10)12(16)9-14(17-13)6-2-1-3-7-14/h4-5,8,15H,1-3,6-7,9H2 |
| InChIKey | MWAGQRLEBNHEKW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |