C11H11NO3 — CID 121207071
6-hydroxyspiro[3H-chromene-2,3'-azetidine]-4-one (PubChem CID 121207071) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 6-hydroxyspiro[3H-chromene-2,3'-azetidine]-4-one.
| Compound Name | 6-hydroxyspiro[3H-chromene-2,3'-azetidine]-4-one |
|---|---|
| PubChem CID | 121207071 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 6-hydroxyspiro[3H-chromene-2,3'-azetidine]-4-one |
| SMILES | O=C1CC2(CNC2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C11H11NO3/c13-7-1-2-10-8(3-7)9(14)4-11(15-10)5-12-6-11/h1-3,12-13H,4-6H2 |
| InChIKey | IAIKIBLOSLMRLP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |