C20H20O5S — CID 10761803
(4-oxospiro[3H-chromene-2,1'-cyclohexane]-6-yl) benzenesulfonate (PubChem CID 10761803) has the molecular formula C20H20O5S and a molecular weight of 372.44 g/mol. Its IUPAC name is (4-oxospiro[3H-chromene-2,1'-cyclohexane]-6-yl) benzenesulfonate.
| Compound Name | (4-oxospiro[3H-chromene-2,1'-cyclohexane]-6-yl) benzenesulfonate |
|---|---|
| PubChem CID | 10761803 |
| Molecular Formula | C20H20O5S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (4-oxospiro[3H-chromene-2,1'-cyclohexane]-6-yl) benzenesulfonate |
| SMILES | O=C1CC2(CCCCC2)Oc2ccc(OS(=O)(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C20H20O5S/c21-18-14-20(11-5-2-6-12-20)24-19-10-9-15(13-17(18)19)25-26(22,23)16-7-3-1-4-8-16/h1,3-4,7-10,13H,2,5-6,11-12,14H2 |
| InChIKey | JGZHPJNFDYQPTH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|