About 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one
1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 100760013) has the molecular formula C21H23NO5S
and a molecular weight of 401.48 g/mol. Its IUPAC name is 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
Molecular Properties
| Compound Name | 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| PubChem CID | 100760013 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1ccc2c(c1)C(=O)CC1(CCN(S(=O)(=O)Cc3ccccc3)CC1)O2 |
| InChI | InChI=1S/C21H23NO5S/c1-26-17-7-8-20-18(13-17)19(23)14-21(27-20)9-11-22(12-10-21)28(24,25)15-16-5-3-2-4-6-16/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | TZTYFEDORFEYJD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one?
The IUPAC name of 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one (CID 100760013) is 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
What is the SMILES notation for 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one?
The canonical SMILES for 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one is COc1ccc2c(c1)C(=O)CC1(CCN(S(=O)(=O)Cc3ccccc3)CC1)O2.
What is the InChIKey of 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one?
The InChIKey is TZTYFEDORFEYJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO5S/c1-26-17-7-8-20-18(13-17)19(23)14-21(27-20)9-11-22(12-10-21)28(24,25)15-16-5-3-2-4-6-16/h2-8,13H,9-12,14-15H2,1H3.
What are the key properties of 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one?
1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one has a molecular weight of 401.48 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-benzylsulfonyl-6-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one is sourced from PubChem (CID 100760013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).