C21H23NO4S — CID 100759022
1'-benzylsulfonyl-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 100759022) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1'-benzylsulfonyl-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-benzylsulfonyl-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 100759022 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1'-benzylsulfonyl-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1ccc2c(c1)OC1(CCN(S(=O)(=O)Cc3ccccc3)CC1)CC2=O |
| InChI | InChI=1S/C21H23NO4S/c1-16-7-8-18-19(23)14-21(26-20(18)13-16)9-11-22(12-10-21)27(24,25)15-17-5-3-2-4-6-17/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | KVEUKCPPFBGIMY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |