C14H18N2O3S — CID 141062958
8-benzylsulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene (PubChem CID 141062958) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 8-benzylsulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene.
| Compound Name | 8-benzylsulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene |
|---|---|
| PubChem CID | 141062958 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 8-benzylsulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCC2(CC=NO2)CC1 |
| InChI | InChI=1S/C14H18N2O3S/c17-20(18,12-13-4-2-1-3-5-13)16-10-7-14(8-11-16)6-9-15-19-14/h1-5,9H,6-8,10-12H2 |
| InChIKey | SFKCDWFFZSGYQD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |