C12H15NO2 — CID 82046047
spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-6-ol (PubChem CID 82046047) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-6-ol.
| Compound Name | spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-6-ol |
|---|---|
| PubChem CID | 82046047 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-6-ol |
| SMILES | Oc1ccc2c(c1)CCC1(CCNC1)O2 |
| InChI | InChI=1S/C12H15NO2/c14-10-1-2-11-9(7-10)3-4-12(15-11)5-6-13-8-12/h1-2,7,13-14H,3-6,8H2 |
| InChIKey | KBXUWFVJZYGQOF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |