C13H17NO — CID 170003759
5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] (PubChem CID 170003759) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine].
| Compound Name | 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] |
|---|---|
| PubChem CID | 170003759 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] |
| SMILES | CCc1ccc2c(c1)CC1(CCNC1)O2 |
| InChI | InChI=1S/C13H17NO/c1-2-10-3-4-12-11(7-10)8-13(15-12)5-6-14-9-13/h3-4,7,14H,2,5-6,8-9H2,1H3 |
| InChIKey | OGLJXFJAQVKSCN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |