About 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine]
5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] (PubChem CID 170003759) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine].
Molecular Properties
| Compound Name | 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] |
| PubChem CID | 170003759 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] |
| SMILES | CCc1ccc2c(c1)CC1(CCNC1)O2 |
| InChI | InChI=1S/C13H17NO/c1-2-10-3-4-12-11(7-10)8-13(15-12)5-6-14-9-13/h3-4,7,14H,2,5-6,8-9H2,1H3 |
| InChIKey | OGLJXFJAQVKSCN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine]?
The IUPAC name of 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] (CID 170003759) is 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine].
What is the SMILES notation for 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine]?
The canonical SMILES for 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] is CCc1ccc2c(c1)CC1(CCNC1)O2.
What is the InChIKey of 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine]?
The InChIKey is OGLJXFJAQVKSCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-2-10-3-4-12-11(7-10)8-13(15-12)5-6-14-9-13/h3-4,7,14H,2,5-6,8-9H2,1H3.
What are the key properties of 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine]?
5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] has a molecular weight of 203.28 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylspiro[3H-1-benzofuran-2,3'-pyrrolidine] is sourced from PubChem (CID 170003759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).