C19H30N2O — CID 82046943
N,N,6-triethylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine (PubChem CID 82046943) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is N,N,6-triethylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine.
| Compound Name | N,N,6-triethylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine |
|---|---|
| PubChem CID | 82046943 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N,N,6-triethylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine |
| SMILES | CCc1ccc2c(c1)C(N(CC)CC)CC1(CCNCC1)O2 |
| InChI | InChI=1S/C19H30N2O/c1-4-15-7-8-18-16(13-15)17(21(5-2)6-3)14-19(22-18)9-11-20-12-10-19/h7-8,13,17,20H,4-6,9-12,14H2,1-3H3 |
| InChIKey | UCGFFUBYOHSTCY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |