C17H22N2O5S — CID 168919146
methyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylcarbamothioylamino]-3,4-dihydro-2H-chromene-6-carboxylate (PubChem CID 168919146) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is methyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylcarbamothioylamino]-3,4-dihydro-2H-chromene-6-carboxylate.
| Compound Name | methyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylcarbamothioylamino]-3,4-dihydro-2H-chromene-6-carboxylate |
|---|---|
| PubChem CID | 168919146 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | methyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylcarbamothioylamino]-3,4-dihydro-2H-chromene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H](NC(=S)NC(=O)OC(C)(C)C)CCO2 |
| InChI | InChI=1S/C17H22N2O5S/c1-17(2,3)24-16(21)19-15(25)18-12-7-8-23-13-6-5-10(9-11(12)13)14(20)22-4/h5-6,9,12H,7-8H2,1-4H3,(H2,18,19,21,25)/t12-/m1/s1 |
| InChIKey | NDPJMVRHNOAVTB-GFCCVEGCSA-N |
| XLogP | 2.70 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|