C12H12Cl3NO2 — CID 108734077
2,2,2-trichloro-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)acetamide (PubChem CID 108734077) has the molecular formula C12H12Cl3NO2 and a molecular weight of 308.59 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)acetamide |
|---|---|
| PubChem CID | 108734077 |
| Molecular Formula | C12H12Cl3NO2 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2,2,2-trichloro-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)acetamide |
| SMILES | Cc1ccc2c(c1)C(NC(=O)C(Cl)(Cl)Cl)CCO2 |
| InChI | InChI=1S/C12H12Cl3NO2/c1-7-2-3-10-8(6-7)9(4-5-18-10)16-11(17)12(13,14)15/h2-3,6,9H,4-5H2,1H3,(H,16,17) |
| InChIKey | WVOHKRKOGSPROU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|