C14H18BrNO2 — CID 108734108
2-bromo-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)butanamide (PubChem CID 108734108) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is 2-bromo-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)butanamide.
| Compound Name | 2-bromo-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)butanamide |
|---|---|
| PubChem CID | 108734108 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-bromo-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)butanamide |
| SMILES | CCC(Br)C(=O)NC1CCOc2ccc(C)cc21 |
| InChI | InChI=1S/C14H18BrNO2/c1-3-11(15)14(17)16-12-6-7-18-13-5-4-9(2)8-10(12)13/h4-5,8,11-12H,3,6-7H2,1-2H3,(H,16,17) |
| InChIKey | CFJLDFLDOYCIOY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|