C24H21NO3 — CID 108757445
2-benzoyl-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)benzamide (PubChem CID 108757445) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-benzoyl-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)benzamide.
| Compound Name | 2-benzoyl-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)benzamide |
|---|---|
| PubChem CID | 108757445 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-benzoyl-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)benzamide |
| SMILES | Cc1ccc2c(c1)C(NC(=O)c1ccccc1C(=O)c1ccccc1)CCO2 |
| InChI | InChI=1S/C24H21NO3/c1-16-11-12-22-20(15-16)21(13-14-28-22)25-24(27)19-10-6-5-9-18(19)23(26)17-7-3-2-4-8-17/h2-12,15,21H,13-14H2,1H3,(H,25,27) |
| InChIKey | VCFKSHPFUOSKAO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |