C18H18N2O4 — CID 108734181
2-methyl-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)-3-nitrobenzamide (PubChem CID 108734181) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-methyl-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)-3-nitrobenzamide.
| Compound Name | 2-methyl-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 108734181 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-methyl-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)-3-nitrobenzamide |
| SMILES | Cc1ccc2c(c1)C(NC(=O)c1cccc([N+](=O)[O-])c1C)CCO2 |
| InChI | InChI=1S/C18H18N2O4/c1-11-6-7-17-14(10-11)15(8-9-24-17)19-18(21)13-4-3-5-16(12(13)2)20(22)23/h3-7,10,15H,8-9H2,1-2H3,(H,19,21) |
| InChIKey | YXUVHXYDADDRCS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|