C31H47N9O18 — CID 152772183
3-[3-[5,8-bis[3-[(2-carboxyacetyl)-hydroxyamino]propyl]-14-methyl-3,6,9,12,15,18-hexaoxo-1,4,7,10,13,16-hexazacyclooctadec-2-yl]propyl-hydroxyamino]-3-oxopropanoic acid (PubChem CID 152772183) has the molecular formula C31H47N9O18 and a molecular weight of 833.76 g/mol. Its IUPAC name is 3-[3-[5,8-bis[3-[(2-carboxyacetyl)-hydroxyamino]propyl]-14-methyl-3,6,9,12,15,18-hexaoxo-1,4,7,10,13,16-hexazacyclooctadec-2-yl]propyl-hydroxyamino]-3-oxopropanoic acid.
| Compound Name | 3-[3-[5,8-bis[3-[(2-carboxyacetyl)-hydroxyamino]propyl]-14-methyl-3,6,9,12,15,18-hexaoxo-1,4,7,10,13,16-hexazacyclooctadec-2-yl]propyl-hydroxyamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 152772183 |
| Molecular Formula | C31H47N9O18 |
| Molecular Weight | 833.76 g/mol |
| Exact Mass | 833.30 |
| IUPAC Name | 3-[3-[5,8-bis[3-[(2-carboxyacetyl)-hydroxyamino]propyl]-14-methyl-3,6,9,12,15,18-hexaoxo-1,4,7,10,13,16-hexazacyclooctadec-2-yl]propyl-hydroxyamino]-3-oxopropanoic acid |
| SMILES | CC1NC(=O)CNC(=O)C(CCCN(O)C(=O)CC(=O)O)NC(=O)C(CCCN(O)C(=O)CC(=O)O)NC(=O)C(CCCN(O)C(=O)CC(=O)O)NC(=O)CNC1=O |
| InChI | InChI=1S/C31H47N9O18/c1-16-28(52)32-15-21(42)35-18(6-3-9-39(57)23(44)12-26(48)49)30(54)37-19(7-4-10-40(58)24(45)13-27(50)51)31(55)36-17(29(53)33-14-20(41)34-16)5-2-8-38(56)22(43)11-25(46)47/h16-19,56-58H,2-15H2,1H3,(H,32,52)(H,33,53)(H,34,41)(H,35,42)(H,36,55)(H,37,54)(H,46,47)(H,48,49)(H,50,51) |
| InChIKey | RKBVBZLUGHDEEW-UHFFFAOYSA-N |
| XLogP | -5.39 |
| TPSA | 408.12 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.76 |
| LogP ≤ 5 | -5.39 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|