C32H57N5O8 — CID 102135544
prop-2-enyl N-[6-[(2S,5S)-2,5-bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3,6-dioxopiperazin-1-yl]hexyl]carbamate (PubChem CID 102135544) has the molecular formula C32H57N5O8 and a molecular weight of 639.84 g/mol. Its IUPAC name is prop-2-enyl N-[6-[(2S,5S)-2,5-bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3,6-dioxopiperazin-1-yl]hexyl]carbamate.
| Compound Name | prop-2-enyl N-[6-[(2S,5S)-2,5-bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3,6-dioxopiperazin-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 102135544 |
| Molecular Formula | C32H57N5O8 |
| Molecular Weight | 639.84 g/mol |
| Exact Mass | 639.42 |
| IUPAC Name | prop-2-enyl N-[6-[(2S,5S)-2,5-bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3,6-dioxopiperazin-1-yl]hexyl]carbamate |
| SMILES | C=CCOC(=O)NCCCCCCN1C(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)[C@@H]1CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H57N5O8/c1-8-23-43-28(40)33-19-13-9-10-16-22-37-25(18-12-15-21-35-30(42)45-32(5,6)7)26(38)36-24(27(37)39)17-11-14-20-34-29(41)44-31(2,3)4/h8,24-25H,1,9-23H2,2-7H3,(H,33,40)(H,34,41)(H,35,42)(H,36,38)/t24-,25-/m0/s1 |
| InChIKey | LFXYZOYVHLSIEE-DQEYMECFSA-N |
| XLogP | 4.54 |
| TPSA | 164.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|