C13H22F3N5O2 — CID 172838508
tert-butyl N-[3-[2-amino-4-imino-6-(trifluoromethyl)-1,2-dihydropyrimidin-3-yl]propyl]carbamate (PubChem CID 172838508) has the molecular formula C13H22F3N5O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is tert-butyl N-[3-[2-amino-4-imino-6-(trifluoromethyl)-1,2-dihydropyrimidin-3-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-amino-4-imino-6-(trifluoromethyl)-1,2-dihydropyrimidin-3-yl]propyl]carbamate |
|---|---|
| PubChem CID | 172838508 |
| Molecular Formula | C13H22F3N5O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl N-[3-[2-amino-4-imino-6-(trifluoromethyl)-1,2-dihydropyrimidin-3-yl]propyl]carbamate |
| SMILES | [H]/N=C1\C=C(C(F)(F)F)NC(N)N1CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22F3N5O2/c1-12(2,3)23-11(22)19-5-4-6-21-9(17)7-8(13(14,15)16)20-10(21)18/h7,10,17,20H,4-6,18H2,1-3H3,(H,19,22)/b17-9+ |
| InChIKey | CLJHZSXSDNBHTH-RQZCQDPDSA-N |
| XLogP | 1.47 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|