C22H37BN4O4 — CID 178046889
tert-butyl N-[3-[2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-imidazo[4,5-b]pyridin-1-yl]propyl]carbamate (PubChem CID 178046889) has the molecular formula C22H37BN4O4 and a molecular weight of 432.37 g/mol. Its IUPAC name is tert-butyl N-[3-[2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-imidazo[4,5-b]pyridin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-imidazo[4,5-b]pyridin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 178046889 |
| Molecular Formula | C22H37BN4O4 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | tert-butyl N-[3-[2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-imidazo[4,5-b]pyridin-1-yl]propyl]carbamate |
| SMILES | CC1N=C2C(=CC(B3OC(C)(C)C(C)(C)O3)=CN2C)N1CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37BN4O4/c1-15-25-18-17(27(15)12-10-11-24-19(28)29-20(2,3)4)13-16(14-26(18)9)23-30-21(5,6)22(7,8)31-23/h13-15H,10-12H2,1-9H3,(H,24,28) |
| InChIKey | NGQUAAMJQHEKPK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|