C27H47BN4O8 — CID 162438434
tert-butyl 3-[[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate (PubChem CID 162438434) has the molecular formula C27H47BN4O8 and a molecular weight of 566.51 g/mol. Its IUPAC name is tert-butyl 3-[[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-[[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 162438434 |
| Molecular Formula | C27H47BN4O8 |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | tert-butyl 3-[[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCCN(Cc1nn(C(=O)OC(C)(C)C)cc1B1OC(C)(C)C(C)(C)O1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H47BN4O8/c1-23(2,3)36-20(33)29-14-15-31(21(34)37-24(4,5)6)17-19-18(28-39-26(10,11)27(12,13)40-28)16-32(30-19)22(35)38-25(7,8)9/h16H,14-15,17H2,1-13H3,(H,29,33) |
| InChIKey | GERQSMVWANINQU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 130.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|