C13H23Cl2N3O4 — CID 118895154
tert-butyl N,N-bis[2-[(2-chloroacetyl)amino]ethyl]carbamate (PubChem CID 118895154) has the molecular formula C13H23Cl2N3O4 and a molecular weight of 356.25 g/mol. Its IUPAC name is tert-butyl N,N-bis[2-[(2-chloroacetyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N,N-bis[2-[(2-chloroacetyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 118895154 |
| Molecular Formula | C13H23Cl2N3O4 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | tert-butyl N,N-bis[2-[(2-chloroacetyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNC(=O)CCl)CCNC(=O)CCl |
| InChI | InChI=1S/C13H23Cl2N3O4/c1-13(2,3)22-12(21)18(6-4-16-10(19)8-14)7-5-17-11(20)9-15/h4-9H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | PNFKOUIJAXUPKW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|