C18H35BN2O4 — CID 142330523
tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]ethyl]carbamate (PubChem CID 142330523) has the molecular formula C18H35BN2O4 and a molecular weight of 354.30 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 142330523 |
| Molecular Formula | C18H35BN2O4 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN1CCC(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C18H35BN2O4/c1-16(2,3)23-15(22)20-10-13-21-11-8-14(9-12-21)19-24-17(4,5)18(6,7)25-19/h14H,8-13H2,1-7H3,(H,20,22) |
| InChIKey | UTTTZUAIQWZFPC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|