C13H27N3O2 — CID 155978007
tert-butyl N-[2-(3,3-dimethylpiperazin-1-yl)ethyl]carbamate (PubChem CID 155978007) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is tert-butyl N-[2-(3,3-dimethylpiperazin-1-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,3-dimethylpiperazin-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 155978007 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | tert-butyl N-[2-(3,3-dimethylpiperazin-1-yl)ethyl]carbamate |
| SMILES | CC1(C)CN(CCNC(=O)OC(C)(C)C)CCN1 |
| InChI | InChI=1S/C13H27N3O2/c1-12(2,3)18-11(17)14-6-8-16-9-7-15-13(4,5)10-16/h15H,6-10H2,1-5H3,(H,14,17) |
| InChIKey | OCCJZBFLJVCSID-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |