C15H24N2O3 — CID 166854624
tert-butyl N-[4-(5-imino-2-oxocyclohex-3-en-1-yl)butyl]carbamate (PubChem CID 166854624) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is tert-butyl N-[4-(5-imino-2-oxocyclohex-3-en-1-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(5-imino-2-oxocyclohex-3-en-1-yl)butyl]carbamate |
|---|---|
| PubChem CID | 166854624 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | tert-butyl N-[4-(5-imino-2-oxocyclohex-3-en-1-yl)butyl]carbamate |
| SMILES | [H]/N=C1\C=CC(=O)C(CCCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H24N2O3/c1-15(2,3)20-14(19)17-9-5-4-6-11-10-12(16)7-8-13(11)18/h7-8,11,16H,4-6,9-10H2,1-3H3,(H,17,19)/b16-12+ |
| InChIKey | PJYWVMBEBNIBNV-FOWTUZBSSA-N |
| XLogP | 2.85 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|