C19H27N3O4S — CID 134107894
tert-butyl N-[4-[(4S)-1-(2-methylsulfanylphenyl)-2,5-dioxoimidazolidin-4-yl]butyl]carbamate (PubChem CID 134107894) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is tert-butyl N-[4-[(4S)-1-(2-methylsulfanylphenyl)-2,5-dioxoimidazolidin-4-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(4S)-1-(2-methylsulfanylphenyl)-2,5-dioxoimidazolidin-4-yl]butyl]carbamate |
|---|---|
| PubChem CID | 134107894 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | tert-butyl N-[4-[(4S)-1-(2-methylsulfanylphenyl)-2,5-dioxoimidazolidin-4-yl]butyl]carbamate |
| SMILES | CSc1ccccc1N1C(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C19H27N3O4S/c1-19(2,3)26-18(25)20-12-8-7-9-13-16(23)22(17(24)21-13)14-10-5-6-11-15(14)27-4/h5-6,10-11,13H,7-9,12H2,1-4H3,(H,20,25)(H,21,24)/t13-/m0/s1 |
| InChIKey | RZVBAQYOFIOTPQ-ZDUSSCGKSA-N |
| XLogP | 3.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|