C14H24N4O6 — CID 101007603
trans-(5S,15S)-5,15-dimethyl-1,10-dioxa-4,7,13,16-tetrazacyclooctadecane-3,6,14,17-tetrone (PubChem CID 101007603) has the molecular formula C14H24N4O6 and a molecular weight of 344.37 g/mol. Its IUPAC name is trans-(5S,15S)-5,15-dimethyl-1,10-dioxa-4,7,13,16-tetrazacyclooctadecane-3,6,14,17-tetrone.
| Compound Name | trans-(5S,15S)-5,15-dimethyl-1,10-dioxa-4,7,13,16-tetrazacyclooctadecane-3,6,14,17-tetrone |
|---|---|
| PubChem CID | 101007603 |
| Molecular Formula | C14H24N4O6 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | trans-(5S,15S)-5,15-dimethyl-1,10-dioxa-4,7,13,16-tetrazacyclooctadecane-3,6,14,17-tetrone |
| SMILES | C[C@@H]1NC(=O)COCC(=O)N[C@@H](C)C(=O)NCCOCCNC1=O |
| InChI | InChI=1S/C14H24N4O6/c1-9-13(21)15-3-5-23-6-4-16-14(22)10(2)18-12(20)8-24-7-11(19)17-9/h9-10H,3-8H2,1-2H3,(H,15,21)(H,16,22)(H,17,19)(H,18,20)/t9-,10-/m0/s1 |
| InChIKey | CECYEBHRTUPAPH-UWVGGRQHSA-N |
| XLogP | -2.72 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |