C20H36N4O7 — CID 101211203
trans-(12S,17S)-12,17-di(propan-2-yl)-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,14,15,18-tetrone (PubChem CID 101211203) has the molecular formula C20H36N4O7 and a molecular weight of 444.53 g/mol. Its IUPAC name is trans-(12S,17S)-12,17-di(propan-2-yl)-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,14,15,18-tetrone.
| Compound Name | trans-(12S,17S)-12,17-di(propan-2-yl)-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,14,15,18-tetrone |
|---|---|
| PubChem CID | 101211203 |
| Molecular Formula | C20H36N4O7 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | trans-(12S,17S)-12,17-di(propan-2-yl)-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,14,15,18-tetrone |
| SMILES | CC(C)[C@@H]1NC(=O)C(=O)N[C@@H](C(C)C)C(=O)NCCOCCOCCOCCNC1=O |
| InChI | InChI=1S/C20H36N4O7/c1-13(2)15-17(25)21-5-7-29-9-11-31-12-10-30-8-6-22-18(26)16(14(3)4)24-20(28)19(27)23-15/h13-16H,5-12H2,1-4H3,(H,21,25)(H,22,26)(H,23,27)(H,24,28)/t15-,16-/m0/s1 |
| InChIKey | SBHUKBABBBIXJB-HOTGVXAUSA-N |
| XLogP | -1.44 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|