C21H35N7O9 — CID 122544643
2-[(5R,10S,14S)-5-(cyclopropylmethyl)-14-(1-hydroxyethyl)-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide (PubChem CID 122544643) has the molecular formula C21H35N7O9 and a molecular weight of 529.55 g/mol. Its IUPAC name is 2-[(5R,10S,14S)-5-(cyclopropylmethyl)-14-(1-hydroxyethyl)-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide.
| Compound Name | 2-[(5R,10S,14S)-5-(cyclopropylmethyl)-14-(1-hydroxyethyl)-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide |
|---|---|
| PubChem CID | 122544643 |
| Molecular Formula | C21H35N7O9 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 2-[(5R,10S,14S)-5-(cyclopropylmethyl)-14-(1-hydroxyethyl)-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide |
| SMILES | CC(O)[C@@H]1NC(=O)N[C@@H](CC(N)=O)C(=O)NNC(=O)[C@@H](CC2CC2)NC(=O)COCCOCCNC1=O |
| InChI | InChI=1S/C21H35N7O9/c1-11(29)17-20(34)23-4-5-36-6-7-37-10-16(31)24-13(8-12-2-3-12)18(32)27-28-19(33)14(9-15(22)30)25-21(35)26-17/h11-14,17,29H,2-10H2,1H3,(H2,22,30)(H,23,34)(H,24,31)(H,27,32)(H,28,33)(H2,25,26,35)/t11?,13-,14+,17+/m1/s1 |
| InChIKey | VBXXVFZBJCIVBK-RTZLZHCESA-N |
| XLogP | -4.13 |
| TPSA | 239.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |