C21H37N7O9 — CID 122544605
2-[(5S,10S,14S)-5-butan-2-yl-14-(1-hydroxyethyl)-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide (PubChem CID 122544605) has the molecular formula C21H37N7O9 and a molecular weight of 531.57 g/mol. Its IUPAC name is 2-[(5S,10S,14S)-5-butan-2-yl-14-(1-hydroxyethyl)-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide.
| Compound Name | 2-[(5S,10S,14S)-5-butan-2-yl-14-(1-hydroxyethyl)-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide |
|---|---|
| PubChem CID | 122544605 |
| Molecular Formula | C21H37N7O9 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 2-[(5S,10S,14S)-5-butan-2-yl-14-(1-hydroxyethyl)-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide |
| SMILES | CCC(C)[C@@H]1NC(=O)COCCOCCNC(=O)[C@H](C(C)O)NC(=O)N[C@@H](CC(N)=O)C(=O)NNC1=O |
| InChI | InChI=1S/C21H37N7O9/c1-4-11(2)16-20(34)28-27-18(32)13(9-14(22)30)24-21(35)26-17(12(3)29)19(33)23-5-6-36-7-8-37-10-15(31)25-16/h11-13,16-17,29H,4-10H2,1-3H3,(H2,22,30)(H,23,33)(H,25,31)(H,27,32)(H,28,34)(H2,24,26,35)/t11?,12?,13-,16-,17-/m0/s1 |
| InChIKey | WNDACCLOFLRPDX-QHMZMSKQSA-N |
| XLogP | -3.88 |
| TPSA | 239.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |