C8H14N2O2 — CID 77105669
(3R)-3-butan-2-ylpiperazine-2,5-dione (PubChem CID 77105669) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (3R)-3-butan-2-ylpiperazine-2,5-dione.
| Compound Name | (3R)-3-butan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 77105669 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (3R)-3-butan-2-ylpiperazine-2,5-dione |
| SMILES | CCC(C)[C@H]1NC(=O)CNC1=O |
| InChI | InChI=1S/C8H14N2O2/c1-3-5(2)7-8(12)9-4-6(11)10-7/h5,7H,3-4H2,1-2H3,(H,9,12)(H,10,11)/t5?,7-/m1/s1 |
| InChIKey | RGYQFKJCIVSAKS-NQPNHJOESA-N |
| XLogP | -0.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |