C34H53N7O8 — CID 73108759
15-benzyl-6-butan-2-yl-9-(1-hydroxyethyl)-3-(2-methylpropyl)-18-propan-2-yl-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone (PubChem CID 73108759) has the molecular formula C34H53N7O8 and a molecular weight of 687.84 g/mol. Its IUPAC name is 15-benzyl-6-butan-2-yl-9-(1-hydroxyethyl)-3-(2-methylpropyl)-18-propan-2-yl-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone.
| Compound Name | 15-benzyl-6-butan-2-yl-9-(1-hydroxyethyl)-3-(2-methylpropyl)-18-propan-2-yl-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone |
|---|---|
| PubChem CID | 73108759 |
| Molecular Formula | C34H53N7O8 |
| Molecular Weight | 687.84 g/mol |
| Exact Mass | 687.40 |
| IUPAC Name | 15-benzyl-6-butan-2-yl-9-(1-hydroxyethyl)-3-(2-methylpropyl)-18-propan-2-yl-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone |
| SMILES | CCC(C)C1NC(=O)C(C(C)O)NC(=O)CNC(=O)C(Cc2ccccc2)NC(=O)C(C(C)C)NC(=O)CNC(=O)C(CC(C)C)NC1=O |
| InChI | InChI=1S/C34H53N7O8/c1-8-20(6)28-33(48)37-23(14-18(2)3)30(45)35-16-25(43)39-27(19(4)5)32(47)38-24(15-22-12-10-9-11-13-22)31(46)36-17-26(44)40-29(21(7)42)34(49)41-28/h9-13,18-21,23-24,27-29,42H,8,14-17H2,1-7H3,(H,35,45)(H,36,46)(H,37,48)(H,38,47)(H,39,43)(H,40,44)(H,41,49) |
| InChIKey | CHVOPJINMUGQNR-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 223.93 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.84 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |