C31H48N6O6 — CID 163114463
15-benzyl-9-butan-2-yl-12-methyl-3-(2-methylpropyl)-6-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 163114463) has the molecular formula C31H48N6O6 and a molecular weight of 600.76 g/mol. Its IUPAC name is 15-benzyl-9-butan-2-yl-12-methyl-3-(2-methylpropyl)-6-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 15-benzyl-9-butan-2-yl-12-methyl-3-(2-methylpropyl)-6-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 163114463 |
| Molecular Formula | C31H48N6O6 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | 15-benzyl-9-butan-2-yl-12-methyl-3-(2-methylpropyl)-6-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | CCC(C)C1NC(=O)C(C)NC(=O)C(Cc2ccccc2)NC(=O)CNC(=O)C(CC(C)C)NC(=O)C(C(C)C)NC1=O |
| InChI | InChI=1S/C31H48N6O6/c1-8-19(6)26-31(43)36-25(18(4)5)30(42)35-22(14-17(2)3)28(40)32-16-24(38)34-23(15-21-12-10-9-11-13-21)29(41)33-20(7)27(39)37-26/h9-13,17-20,22-23,25-26H,8,14-16H2,1-7H3,(H,32,40)(H,33,41)(H,34,38)(H,35,42)(H,36,43)(H,37,39) |
| InChIKey | VKNHTCYGYOTZHQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 174.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |