C17H30N4O4 — CID 24853605
(3S,6S,9S)-3,6-bis[(2S)-butan-2-yl]-9-methyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone (PubChem CID 24853605) has the molecular formula C17H30N4O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (3S,6S,9S)-3,6-bis[(2S)-butan-2-yl]-9-methyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S)-3,6-bis[(2S)-butan-2-yl]-9-methyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 24853605 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | (3S,6S,9S)-3,6-bis[(2S)-butan-2-yl]-9-methyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H]([C@@H](C)CC)NC1=O |
| InChI | InChI=1S/C17H30N4O4/c1-6-9(3)13-16(24)18-8-12(22)19-11(5)15(23)20-14(10(4)7-2)17(25)21-13/h9-11,13-14H,6-8H2,1-5H3,(H,18,24)(H,19,22)(H,20,23)(H,21,25)/t9-,10-,11-,13-,14-/m0/s1 |
| InChIKey | VDWWRSCFVPXUGX-GRLWGSQLSA-N |
| XLogP | -0.32 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |