C20H37N7O10 — CID 158552077
2-[(5R,10R,14R)-5-(1-hydroxyethyl)-14-(hydroxymethyl)-7-methyl-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide;methane (PubChem CID 158552077) has the molecular formula C20H37N7O10 and a molecular weight of 535.56 g/mol. Its IUPAC name is 2-[(5R,10R,14R)-5-(1-hydroxyethyl)-14-(hydroxymethyl)-7-methyl-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide;methane.
| Compound Name | 2-[(5R,10R,14R)-5-(1-hydroxyethyl)-14-(hydroxymethyl)-7-methyl-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide;methane |
|---|---|
| PubChem CID | 158552077 |
| Molecular Formula | C20H37N7O10 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 2-[(5R,10R,14R)-5-(1-hydroxyethyl)-14-(hydroxymethyl)-7-methyl-3,6,9,12,15-pentaoxo-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicos-10-yl]acetamide;methane |
| SMILES | C.CC(O)[C@H]1NC(=O)COCCOCCNC(=O)[C@@H](CO)NC(=O)N[C@H](CC(N)=O)C(=O)NN(C)C1=O |
| InChI | InChI=1S/C19H33N7O10.CH4/c1-10(28)15-18(33)26(2)25-17(32)11(7-13(20)29)22-19(34)23-12(8-27)16(31)21-3-4-35-5-6-36-9-14(30)24-15;/h10-12,15,27-28H,3-9H2,1-2H3,(H2,20,29)(H,21,31)(H,24,30)(H,25,32)(H2,22,23,34);1H4/t10?,11-,12-,15-;/m1./s1 |
| InChIKey | HPVPTDYGFPYUOS-QGMBGMHYSA-N |
| XLogP | -4.96 |
| TPSA | 250.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | -4.96 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |