C21H35N7O7 — CID 123519715
2-(9-butan-2-yl-10-methyl-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazacycloicos-3-yl)acetamide (PubChem CID 123519715) has the molecular formula C21H35N7O7 and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-(9-butan-2-yl-10-methyl-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazacycloicos-3-yl)acetamide.
| Compound Name | 2-(9-butan-2-yl-10-methyl-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazacycloicos-3-yl)acetamide |
|---|---|
| PubChem CID | 123519715 |
| Molecular Formula | C21H35N7O7 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 2-(9-butan-2-yl-10-methyl-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazacycloicos-3-yl)acetamide |
| SMILES | CCC(C)C1C(=O)NCC(=O)NC(CC(N)=O)C(=O)NCCCC(=O)NCC(=O)NCC(=O)N1C |
| InChI | InChI=1S/C21H35N7O7/c1-4-12(2)19-21(35)26-10-17(32)27-13(8-14(22)29)20(34)23-7-5-6-15(30)24-9-16(31)25-11-18(33)28(19)3/h12-13,19H,4-11H2,1-3H3,(H2,22,29)(H,23,34)(H,24,30)(H,25,31)(H,26,35)(H,27,32) |
| InChIKey | JSDDUWGGLVSWJT-UHFFFAOYSA-N |
| XLogP | -3.52 |
| TPSA | 208.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |