C27H41N6O10P — CID 53319794
[4-[[(2S,5S,8S)-8-(2-amino-2-oxoethyl)-3,6,9,12,20-pentaoxo-5-propan-2-yl-1,4,7,10,13-pentazacycloicos-2-yl]methyl]phenyl] dihydrogen phosphate (PubChem CID 53319794) has the molecular formula C27H41N6O10P and a molecular weight of 640.63 g/mol. Its IUPAC name is [4-[[(2S,5S,8S)-8-(2-amino-2-oxoethyl)-3,6,9,12,20-pentaoxo-5-propan-2-yl-1,4,7,10,13-pentazacycloicos-2-yl]methyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[[(2S,5S,8S)-8-(2-amino-2-oxoethyl)-3,6,9,12,20-pentaoxo-5-propan-2-yl-1,4,7,10,13-pentazacycloicos-2-yl]methyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 53319794 |
| Molecular Formula | C27H41N6O10P |
| Molecular Weight | 640.63 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | [4-[[(2S,5S,8S)-8-(2-amino-2-oxoethyl)-3,6,9,12,20-pentaoxo-5-propan-2-yl-1,4,7,10,13-pentazacycloicos-2-yl]methyl]phenyl] dihydrogen phosphate |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](Cc2ccc(OP(=O)(O)O)cc2)NC(=O)CCCCCCNC(=O)CNC(=O)[C@H](CC(N)=O)NC1=O |
| InChI | InChI=1S/C27H41N6O10P/c1-16(2)24-27(39)32-20(14-21(28)34)25(37)30-15-23(36)29-12-6-4-3-5-7-22(35)31-19(26(38)33-24)13-17-8-10-18(11-9-17)43-44(40,41)42/h8-11,16,19-20,24H,3-7,12-15H2,1-2H3,(H2,28,34)(H,29,36)(H,30,37)(H,31,35)(H,32,39)(H,33,38)(H2,40,41,42)/t19-,20-,24-/m0/s1 |
| InChIKey | VBPPBJHLEHWQME-SKPFHBQLSA-N |
| XLogP | -1.12 |
| TPSA | 255.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.63 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|