C22H41N7O8 — CID 134256175
trans-(10S,14S)-10-(4-aminobutyl)-5-butan-2-yl-14-(hydroxymethyl)-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicosane-3,6,9,12,15-pentone (PubChem CID 134256175) has the molecular formula C22H41N7O8 and a molecular weight of 531.61 g/mol. Its IUPAC name is trans-(10S,14S)-10-(4-aminobutyl)-5-butan-2-yl-14-(hydroxymethyl)-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicosane-3,6,9,12,15-pentone.
| Compound Name | trans-(10S,14S)-10-(4-aminobutyl)-5-butan-2-yl-14-(hydroxymethyl)-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicosane-3,6,9,12,15-pentone |
|---|---|
| PubChem CID | 134256175 |
| Molecular Formula | C22H41N7O8 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | trans-(10S,14S)-10-(4-aminobutyl)-5-butan-2-yl-14-(hydroxymethyl)-1,19-dioxa-4,7,8,11,13,16-hexazacyclohenicosane-3,6,9,12,15-pentone |
| SMILES | CCC(C)C1NC(=O)COCCOCCNC(=O)[C@H](CO)NC(=O)N[C@@H](CCCCN)C(=O)NNC1=O |
| InChI | InChI=1S/C22H41N7O8/c1-3-14(2)18-21(34)29-28-20(33)15(6-4-5-7-23)25-22(35)26-16(12-30)19(32)24-8-9-36-10-11-37-13-17(31)27-18/h14-16,18,30H,3-13,23H2,1-2H3,(H,24,32)(H,27,31)(H,28,33)(H,29,34)(H2,25,26,35)/t14?,15-,16-,18?/m0/s1 |
| InChIKey | OYTRYNBFCCTNNP-LPMVOBIJSA-N |
| XLogP | -3.01 |
| TPSA | 222.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|