C30H42N6O4 — CID 177436992
(5S)-4,5-diphenyl-9,18-di(propan-2-yl)-1,3,6,8,11,16-hexazacyclooctadecane-2,7,10,17-tetrone (PubChem CID 177436992) has the molecular formula C30H42N6O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is (5S)-4,5-diphenyl-9,18-di(propan-2-yl)-1,3,6,8,11,16-hexazacyclooctadecane-2,7,10,17-tetrone.
| Compound Name | (5S)-4,5-diphenyl-9,18-di(propan-2-yl)-1,3,6,8,11,16-hexazacyclooctadecane-2,7,10,17-tetrone |
|---|---|
| PubChem CID | 177436992 |
| Molecular Formula | C30H42N6O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | (5S)-4,5-diphenyl-9,18-di(propan-2-yl)-1,3,6,8,11,16-hexazacyclooctadecane-2,7,10,17-tetrone |
| SMILES | CC(C)C1NC(=O)NC(c2ccccc2)[C@H](c2ccccc2)NC(=O)NC(C(C)C)C(=O)NCCCCNC1=O |
| InChI | InChI=1S/C30H42N6O4/c1-19(2)23-27(37)31-17-11-12-18-32-28(38)24(20(3)4)34-30(40)36-26(22-15-9-6-10-16-22)25(35-29(39)33-23)21-13-7-5-8-14-21/h5-10,13-16,19-20,23-26H,11-12,17-18H2,1-4H3,(H,31,37)(H,32,38)(H2,33,35,39)(H2,34,36,40)/t23?,24?,25-,26?/m0/s1 |
| InChIKey | LXBGONDPMRNIHY-BBJQCEGISA-N |
| XLogP | 3.14 |
| TPSA | 140.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |