C12H19N3O3 — CID 91306722
4-(3-oxoaziridin-2-yl)-N-[4-(3-oxoaziridin-2-yl)butyl]butanamide (PubChem CID 91306722) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(3-oxoaziridin-2-yl)-N-[4-(3-oxoaziridin-2-yl)butyl]butanamide.
| Compound Name | 4-(3-oxoaziridin-2-yl)-N-[4-(3-oxoaziridin-2-yl)butyl]butanamide |
|---|---|
| PubChem CID | 91306722 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 4-(3-oxoaziridin-2-yl)-N-[4-(3-oxoaziridin-2-yl)butyl]butanamide |
| SMILES | O=C(CCCC1NC1=O)NCCCCC1NC1=O |
| InChI | InChI=1S/C12H19N3O3/c16-10(6-3-5-9-12(18)15-9)13-7-2-1-4-8-11(17)14-8/h8-9H,1-7H2,(H,13,16)(H,14,17)(H,15,18) |
| InChIKey | KDFYBIIGBVNFBI-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|