C22H31N3O7 — CID 160746646
(E)-4-[4-[5-[(E)-6,9-dioxodec-7-enyl]-3,6-dioxopiperazin-2-yl]butylamino]-4-oxobut-2-enoic acid (PubChem CID 160746646) has the molecular formula C22H31N3O7 and a molecular weight of 449.50 g/mol. Its IUPAC name is (E)-4-[4-[5-[(E)-6,9-dioxodec-7-enyl]-3,6-dioxopiperazin-2-yl]butylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[5-[(E)-6,9-dioxodec-7-enyl]-3,6-dioxopiperazin-2-yl]butylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 160746646 |
| Molecular Formula | C22H31N3O7 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (E)-4-[4-[5-[(E)-6,9-dioxodec-7-enyl]-3,6-dioxopiperazin-2-yl]butylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(=O)/C=C/C(=O)CCCCCC1NC(=O)C(CCCCNC(=O)/C=C/C(=O)O)NC1=O |
| InChI | InChI=1S/C22H31N3O7/c1-15(26)10-11-16(27)7-3-2-4-8-17-21(31)25-18(22(32)24-17)9-5-6-14-23-19(28)12-13-20(29)30/h10-13,17-18H,2-9,14H2,1H3,(H,23,28)(H,24,32)(H,25,31)(H,29,30)/b11-10+,13-12+ |
| InChIKey | RWGRYSPSAXUAFP-AQASXUMVSA-N |
| XLogP | 0.56 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|