C20H28N4O6 — CID 72944881
(Z)-N-[4-[5-[(Z)-4-amino-5,8-dioxooct-6-enyl]-3,6-dioxopiperazin-2-yl]butyl]-4-oxobut-2-enamide (PubChem CID 72944881) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is (Z)-N-[4-[5-[(Z)-4-amino-5,8-dioxooct-6-enyl]-3,6-dioxopiperazin-2-yl]butyl]-4-oxobut-2-enamide.
| Compound Name | (Z)-N-[4-[5-[(Z)-4-amino-5,8-dioxooct-6-enyl]-3,6-dioxopiperazin-2-yl]butyl]-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 72944881 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (Z)-N-[4-[5-[(Z)-4-amino-5,8-dioxooct-6-enyl]-3,6-dioxopiperazin-2-yl]butyl]-4-oxobut-2-enamide |
| SMILES | NC(CCCC1NC(=O)C(CCCCNC(=O)/C=C\C=O)NC1=O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C20H28N4O6/c21-14(17(27)9-4-12-25)6-3-8-16-20(30)23-15(19(29)24-16)7-1-2-11-22-18(28)10-5-13-26/h4-5,9-10,12-16H,1-3,6-8,11,21H2,(H,22,28)(H,23,30)(H,24,29)/b9-4-,10-5- |
| InChIKey | XUHIYTSOMFHUHK-AVWDGMTFSA-N |
| XLogP | -1.17 |
| TPSA | 164.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|