C10H18N4O3 — CID 171116500
2-[(2S,5S)-5-(4-aminobutyl)-3,6-dioxopiperazin-2-yl]acetamide (PubChem CID 171116500) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-[(2S,5S)-5-(4-aminobutyl)-3,6-dioxopiperazin-2-yl]acetamide.
| Compound Name | 2-[(2S,5S)-5-(4-aminobutyl)-3,6-dioxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 171116500 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 2-[(2S,5S)-5-(4-aminobutyl)-3,6-dioxopiperazin-2-yl]acetamide |
| SMILES | NCCCC[C@@H]1NC(=O)[C@H](CC(N)=O)NC1=O |
| InChI | InChI=1S/C10H18N4O3/c11-4-2-1-3-6-9(16)14-7(5-8(12)15)10(17)13-6/h6-7H,1-5,11H2,(H2,12,15)(H,13,17)(H,14,16)/t6-,7-/m0/s1 |
| InChIKey | WMAYQYQGFDMNMH-BQBZGAKWSA-N |
| XLogP | -2.03 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|