C9H14N4O4 — CID 102304528
3-[(2S,5S)-5-(2-amino-2-oxoethyl)-3,6-dioxopiperazin-2-yl]propanamide (PubChem CID 102304528) has the molecular formula C9H14N4O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-[(2S,5S)-5-(2-amino-2-oxoethyl)-3,6-dioxopiperazin-2-yl]propanamide.
| Compound Name | 3-[(2S,5S)-5-(2-amino-2-oxoethyl)-3,6-dioxopiperazin-2-yl]propanamide |
|---|---|
| PubChem CID | 102304528 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-[(2S,5S)-5-(2-amino-2-oxoethyl)-3,6-dioxopiperazin-2-yl]propanamide |
| SMILES | NC(=O)CC[C@@H]1NC(=O)[C@H](CC(N)=O)NC1=O |
| InChI | InChI=1S/C9H14N4O4/c10-6(14)2-1-4-8(16)13-5(3-7(11)15)9(17)12-4/h4-5H,1-3H2,(H2,10,14)(H2,11,15)(H,12,17)(H,13,16)/t4-,5-/m0/s1 |
| InChIKey | QPEGAVDOYFYNJA-WHFBIAKZSA-N |
| XLogP | -2.89 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |