C11H19N3O3 — CID 57400085
3-[(2S,5S)-5-(2-methylpropyl)-3,6-dioxopiperazin-2-yl]propanamide (PubChem CID 57400085) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-[(2S,5S)-5-(2-methylpropyl)-3,6-dioxopiperazin-2-yl]propanamide.
| Compound Name | 3-[(2S,5S)-5-(2-methylpropyl)-3,6-dioxopiperazin-2-yl]propanamide |
|---|---|
| PubChem CID | 57400085 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 3-[(2S,5S)-5-(2-methylpropyl)-3,6-dioxopiperazin-2-yl]propanamide |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](CCC(N)=O)NC1=O |
| InChI | InChI=1S/C11H19N3O3/c1-6(2)5-8-11(17)13-7(10(16)14-8)3-4-9(12)15/h6-8H,3-5H2,1-2H3,(H2,12,15)(H,13,17)(H,14,16)/t7-,8-/m0/s1 |
| InChIKey | PNSJDEJVDJHGLZ-YUMQZZPRSA-N |
| XLogP | -0.72 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |